About N,N-diethylethanamine;1-methoxy-4-methylcyclohexane
N,N-diethylethanamine;1-methoxy-4-methylcyclohexane (PubChem CID 91392056) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is N,N-diethylethanamine;1-methoxy-4-methylcyclohexane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;1-methoxy-4-methylcyclohexane |
| PubChem CID | 91392056 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N,N-diethylethanamine;1-methoxy-4-methylcyclohexane |
| SMILES | CCN(CC)CC.COC1CCC(C)CC1 |
| InChI | InChI=1S/C8H16O.C6H15N/c1-7-3-5-8(9-2)6-4-7;1-4-7(5-2)6-3/h7-8H,3-6H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | LRIDVXMSBMSFDB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;1-methoxy-4-methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;1-methoxy-4-methylcyclohexane?
The IUPAC name of N,N-diethylethanamine;1-methoxy-4-methylcyclohexane (CID 91392056) is N,N-diethylethanamine;1-methoxy-4-methylcyclohexane.
What is the SMILES notation for N,N-diethylethanamine;1-methoxy-4-methylcyclohexane?
The canonical SMILES for N,N-diethylethanamine;1-methoxy-4-methylcyclohexane is CCN(CC)CC.COC1CCC(C)CC1.
What is the InChIKey of N,N-diethylethanamine;1-methoxy-4-methylcyclohexane?
The InChIKey is LRIDVXMSBMSFDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C6H15N/c1-7-3-5-8(9-2)6-4-7;1-4-7(5-2)6-3/h7-8H,3-6H2,1-2H3;4-6H2,1-3H3.
What are the key properties of N,N-diethylethanamine;1-methoxy-4-methylcyclohexane?
N,N-diethylethanamine;1-methoxy-4-methylcyclohexane has a molecular weight of 229.41 g/mol, XLogP of 3.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;1-methoxy-4-methylcyclohexane is sourced from PubChem (CID 91392056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).