C31H36N4O2 — CID 91392135
2-benzyl-N-[[2-butoxy-5-(2-methyl-3H-benzimidazol-5-yl)phenyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 91392135) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 2-benzyl-N-[[2-butoxy-5-(2-methyl-3H-benzimidazol-5-yl)phenyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-benzyl-N-[[2-butoxy-5-(2-methyl-3H-benzimidazol-5-yl)phenyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 91392135 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 2-benzyl-N-[[2-butoxy-5-(2-methyl-3H-benzimidazol-5-yl)phenyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | CCCCOc1ccc(-c2ccc3nc(C)[nH]c3c2)cc1CNC(=O)N1CCCC1Cc1ccccc1 |
| InChI | InChI=1S/C31H36N4O2/c1-3-4-17-37-30-15-13-24(25-12-14-28-29(20-25)34-22(2)33-28)19-26(30)21-32-31(36)35-16-8-11-27(35)18-23-9-6-5-7-10-23/h5-7,9-10,12-15,19-20,27H,3-4,8,11,16-18,21H2,1-2H3,(H,32,36)(H,33,34) |
| InChIKey | NVSMTLOIIVTLCX-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|