C10H21F3N2O2S — CID 91392136
5-amino-2,2,4,4-tetramethyl-N-(trifluoromethyl)pentane-1-sulfonamide (PubChem CID 91392136) has the molecular formula C10H21F3N2O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 5-amino-2,2,4,4-tetramethyl-N-(trifluoromethyl)pentane-1-sulfonamide.
| Compound Name | 5-amino-2,2,4,4-tetramethyl-N-(trifluoromethyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 91392136 |
| Molecular Formula | C10H21F3N2O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-amino-2,2,4,4-tetramethyl-N-(trifluoromethyl)pentane-1-sulfonamide |
| SMILES | CC(C)(CN)CC(C)(C)CS(=O)(=O)NC(F)(F)F |
| InChI | InChI=1S/C10H21F3N2O2S/c1-8(2,6-14)5-9(3,4)7-18(16,17)15-10(11,12)13/h15H,5-7,14H2,1-4H3 |
| InChIKey | MLYGTVOPUUXHLY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|