C14H12N2O4 — CID 91392327
3-(2-cyanopropan-2-yl)indole-1,5-dicarboxylic acid (PubChem CID 91392327) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-(2-cyanopropan-2-yl)indole-1,5-dicarboxylic acid.
| Compound Name | 3-(2-cyanopropan-2-yl)indole-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 91392327 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-(2-cyanopropan-2-yl)indole-1,5-dicarboxylic acid |
| SMILES | CC(C)(C#N)c1cn(C(=O)O)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C14H12N2O4/c1-14(2,7-15)10-6-16(13(19)20)11-4-3-8(12(17)18)5-9(10)11/h3-6H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | XBWLWPKWVZMWRN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |