About 1-methyl-4,5-dimethylidenepyrazole
1-methyl-4,5-dimethylidenepyrazole (PubChem CID 91392542) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 1-methyl-4,5-dimethylidenepyrazole.
Molecular Properties
| Compound Name | 1-methyl-4,5-dimethylidenepyrazole |
| PubChem CID | 91392542 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 1-methyl-4,5-dimethylidenepyrazole |
| SMILES | C=c1cnn(C)c1=C |
| InChI | InChI=1S/C6H8N2/c1-5-4-7-8(3)6(5)2/h4H,1-2H2,3H3 |
| InChIKey | LTQJHHOBYUAAJP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4,5-dimethylidenepyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,5-dimethylidenepyrazole?
The IUPAC name of 1-methyl-4,5-dimethylidenepyrazole (CID 91392542) is 1-methyl-4,5-dimethylidenepyrazole.
What is the SMILES notation for 1-methyl-4,5-dimethylidenepyrazole?
The canonical SMILES for 1-methyl-4,5-dimethylidenepyrazole is C=c1cnn(C)c1=C.
What is the InChIKey of 1-methyl-4,5-dimethylidenepyrazole?
The InChIKey is LTQJHHOBYUAAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-5-4-7-8(3)6(5)2/h4H,1-2H2,3H3.
What are the key properties of 1-methyl-4,5-dimethylidenepyrazole?
1-methyl-4,5-dimethylidenepyrazole has a molecular weight of 108.14 g/mol, XLogP of -0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5-dimethylidenepyrazole is sourced from PubChem (CID 91392542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).