C13H12F8N4 — CID 91392621
5-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-1-[[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl]pyrazole (PubChem CID 91392621) has the molecular formula C13H12F8N4 and a molecular weight of 376.25 g/mol. Its IUPAC name is 5-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-1-[[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl]pyrazole.
| Compound Name | 5-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-1-[[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 91392621 |
| Molecular Formula | C13H12F8N4 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-ethyl-3-(1,1,2,2,2-pentafluoroethyl)-1-[[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl]pyrazole |
| SMILES | CCc1cc(C(F)(F)C(F)(F)F)nn1Cc1cn[nH]c1CC(F)(F)F |
| InChI | InChI=1S/C13H12F8N4/c1-2-8-3-10(12(17,18)13(19,20)21)24-25(8)6-7-5-22-23-9(7)4-11(14,15)16/h3,5H,2,4,6H2,1H3,(H,22,23) |
| InChIKey | YPJXZWFSUJKQNR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|