About N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane
N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane (PubChem CID 91392952) has the molecular formula C14H33NO
and a molecular weight of 231.42 g/mol. Its IUPAC name is N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane.
Molecular Properties
| Compound Name | N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane |
| PubChem CID | 91392952 |
| Molecular Formula | C14H33NO |
| Molecular Weight | 231.42 g/mol |
| Exact Mass | 231.26 |
| IUPAC Name | N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane |
| SMILES | CCC.CCC(CCN(CC)CC)COC |
| InChI | InChI=1S/C11H25NO.C3H8/c1-5-11(10-13-4)8-9-12(6-2)7-3;1-3-2/h11H,5-10H2,1-4H3;3H2,1-2H3 |
| InChIKey | ZQRKTIZTABZBAB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane?
The IUPAC name of N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane (CID 91392952) is N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane.
What is the SMILES notation for N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane?
The canonical SMILES for N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane is CCC.CCC(CCN(CC)CC)COC.
What is the InChIKey of N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane?
The InChIKey is ZQRKTIZTABZBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO.C3H8/c1-5-11(10-13-4)8-9-12(6-2)7-3;1-3-2/h11H,5-10H2,1-4H3;3H2,1-2H3.
What are the key properties of N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane?
N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane has a molecular weight of 231.42 g/mol, XLogP of 3.81, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-(methoxymethyl)pentan-1-amine;propane is sourced from PubChem (CID 91392952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).