C28H40N4O8 — CID 91393220
1-(8-methoxyoctyl)-3-methyl-1,3-diazinane-2,4,6-trione;1-[2-(4-methoxyphenyl)ethyl]-3-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 91393220) has the molecular formula C28H40N4O8 and a molecular weight of 560.65 g/mol. Its IUPAC name is 1-(8-methoxyoctyl)-3-methyl-1,3-diazinane-2,4,6-trione;1-[2-(4-methoxyphenyl)ethyl]-3-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(8-methoxyoctyl)-3-methyl-1,3-diazinane-2,4,6-trione;1-[2-(4-methoxyphenyl)ethyl]-3-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 91393220 |
| Molecular Formula | C28H40N4O8 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 1-(8-methoxyoctyl)-3-methyl-1,3-diazinane-2,4,6-trione;1-[2-(4-methoxyphenyl)ethyl]-3-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | COCCCCCCCCN1C(=O)CC(=O)N(C)C1=O.COc1ccc(CCN2C(=O)CC(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C14H16N2O4.C14H24N2O4/c1-15-12(17)9-13(18)16(14(15)19)8-7-10-3-5-11(20-2)6-4-10;1-15-12(17)11-13(18)16(14(15)19)9-7-5-3-4-6-8-10-20-2/h3-6H,7-9H2,1-2H3;3-11H2,1-2H3 |
| InChIKey | IOJZTTCXQHYOQZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 133.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|