C13H10FN3O4S — CID 91393308
carbamoyl 2-(carbamoylamino)-5-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 91393308) has the molecular formula C13H10FN3O4S and a molecular weight of 323.31 g/mol. Its IUPAC name is carbamoyl 2-(carbamoylamino)-5-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | carbamoyl 2-(carbamoylamino)-5-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91393308 |
| Molecular Formula | C13H10FN3O4S |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | carbamoyl 2-(carbamoylamino)-5-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | NC(=O)Nc1sc(-c2ccc(F)cc2)cc1C(=O)OC(N)=O |
| InChI | InChI=1S/C13H10FN3O4S/c14-7-3-1-6(2-4-7)9-5-8(11(18)21-13(16)20)10(22-9)17-12(15)19/h1-5H,(H2,16,20)(H3,15,17,19) |
| InChIKey | QBHWBEIQWLDJAK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|