About 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine
1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine (PubChem CID 91393364) has the molecular formula C9H23N3
and a molecular weight of 173.30 g/mol. Its IUPAC name is 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine.
Molecular Properties
| Compound Name | 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine |
| PubChem CID | 91393364 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine |
| SMILES | CCCN(C)C(CCN)NCC |
| InChI | InChI=1S/C9H23N3/c1-4-8-12(3)9(6-7-10)11-5-2/h9,11H,4-8,10H2,1-3H3 |
| InChIKey | JMCORHAKCRCOTL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine?
The IUPAC name of 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine (CID 91393364) is 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine.
What is the SMILES notation for 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine?
The canonical SMILES for 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine is CCCN(C)C(CCN)NCC.
What is the InChIKey of 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine?
The InChIKey is JMCORHAKCRCOTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23N3/c1-4-8-12(3)9(6-7-10)11-5-2/h9,11H,4-8,10H2,1-3H3.
What are the key properties of 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine?
1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine has a molecular weight of 173.30 g/mol, XLogP of 0.61, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-ethyl-1-N'-methyl-1-N'-propylpropane-1,1,3-triamine is sourced from PubChem (CID 91393364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).