About propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate
propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate (PubChem CID 91393566) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate.
Molecular Properties
| Compound Name | propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate |
| PubChem CID | 91393566 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate |
| SMILES | CCCOC(=O)C=CC1CCC(=O)C(=O)C1 |
| InChI | InChI=1S/C12H16O4/c1-2-7-16-12(15)6-4-9-3-5-10(13)11(14)8-9/h4,6,9H,2-3,5,7-8H2,1H3 |
| InChIKey | IYXMOOPLPGGYLI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate?
The IUPAC name of propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate (CID 91393566) is propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate.
What is the SMILES notation for propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate?
The canonical SMILES for propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate is CCCOC(=O)C=CC1CCC(=O)C(=O)C1.
What is the InChIKey of propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate?
The InChIKey is IYXMOOPLPGGYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-2-7-16-12(15)6-4-9-3-5-10(13)11(14)8-9/h4,6,9H,2-3,5,7-8H2,1H3.
What are the key properties of propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate?
propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate has a molecular weight of 224.26 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-(3,4-dioxocyclohexyl)prop-2-enoate is sourced from PubChem (CID 91393566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).