C16H10N6 — CID 91393716
bis(1,8-naphthyridin-2-yl)diazene (PubChem CID 91393716) has the molecular formula C16H10N6 and a molecular weight of 286.30 g/mol. Its IUPAC name is bis(1,8-naphthyridin-2-yl)diazene.
| Compound Name | bis(1,8-naphthyridin-2-yl)diazene |
|---|---|
| PubChem CID | 91393716 |
| Molecular Formula | C16H10N6 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | bis(1,8-naphthyridin-2-yl)diazene |
| SMILES | c1cnc2nc(/N=N/c3ccc4cccnc4n3)ccc2c1 |
| InChI | InChI=1S/C16H10N6/c1-3-11-5-7-13(19-15(11)17-9-1)21-22-14-8-6-12-4-2-10-18-16(12)20-14/h1-10H/b22-21+ |
| InChIKey | CEKOWCWBANUERG-QURGRASLSA-N |
| XLogP | 3.99 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|