C28H29N3O3 — CID 91393791
2-[(3S,5S)-3,5-dibenzoyl-4-phenylpiperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 91393791) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[(3S,5S)-3,5-dibenzoyl-4-phenylpiperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3S,5S)-3,5-dibenzoyl-4-phenylpiperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 91393791 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[(3S,5S)-3,5-dibenzoyl-4-phenylpiperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C[C@@H](C(=O)c2ccccc2)N(c2ccccc2)[C@H](C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H29N3O3/c1-29(2)26(32)20-30-18-24(27(33)21-12-6-3-7-13-21)31(23-16-10-5-11-17-23)25(19-30)28(34)22-14-8-4-9-15-22/h3-17,24-25H,18-20H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | QGUFAWVJACJVDO-DQEYMECFSA-N |
| XLogP | 3.40 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |