About 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one
4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one (PubChem CID 91393810) has the molecular formula C12H12F2N4O2
and a molecular weight of 282.25 g/mol. Its IUPAC name is 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one |
| PubChem CID | 91393810 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=Nc1c(F)ccc(CC(O)C2CNC(=O)C2)c1F |
| InChI | InChI=1S/C12H12F2N4O2/c13-8-2-1-6(11(14)12(8)17-18-15)3-9(19)7-4-10(20)16-5-7/h1-2,7,9,19H,3-5H2,(H,16,20) |
| InChIKey | CQEBNQDBZCDIOF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one?
The IUPAC name of 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one (CID 91393810) is 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one?
The canonical SMILES for 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one is [N-]=[N+]=Nc1c(F)ccc(CC(O)C2CNC(=O)C2)c1F.
What is the InChIKey of 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one?
The InChIKey is CQEBNQDBZCDIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N4O2/c13-8-2-1-6(11(14)12(8)17-18-15)3-9(19)7-4-10(20)16-5-7/h1-2,7,9,19H,3-5H2,(H,16,20).
What are the key properties of 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one?
4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one has a molecular weight of 282.25 g/mol, XLogP of 1.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3-azido-2,4-difluorophenyl)-1-hydroxyethyl]pyrrolidin-2-one is sourced from PubChem (CID 91393810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).