C22H34O4 — CID 91393917
(10S,13S,14R,17R)-3,17-dihydroxy-17-(1-hydroxyethyl)-4,10,13-trimethyl-2,3,4,5,6,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one (PubChem CID 91393917) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (10S,13S,14R,17R)-3,17-dihydroxy-17-(1-hydroxyethyl)-4,10,13-trimethyl-2,3,4,5,6,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one.
| Compound Name | (10S,13S,14R,17R)-3,17-dihydroxy-17-(1-hydroxyethyl)-4,10,13-trimethyl-2,3,4,5,6,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 91393917 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (10S,13S,14R,17R)-3,17-dihydroxy-17-(1-hydroxyethyl)-4,10,13-trimethyl-2,3,4,5,6,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one |
| SMILES | CC1C(O)CC[C@]2(C)C3=C(C(=O)CC12)[C@@H]1CC[C@](O)(C(C)O)[C@@]1(C)CC3 |
| InChI | InChI=1S/C22H34O4/c1-12-16-11-18(25)19-14(20(16,3)8-7-17(12)24)5-9-21(4)15(19)6-10-22(21,26)13(2)23/h12-13,15-17,23-24,26H,5-11H2,1-4H3/t12?,13?,15-,16?,17?,20+,21-,22-/m0/s1 |
| InChIKey | MHAYDOHKEQXCEG-XSVZMWQCSA-N |
| XLogP | 2.99 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |