C25H15BrF5N4+ — CID 91394205
5-[[4-[4-bromo-3-(trifluoromethyl)phenyl]phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium (PubChem CID 91394205) has the molecular formula C25H15BrF5N4+ and a molecular weight of 546.32 g/mol. Its IUPAC name is 5-[[4-[4-bromo-3-(trifluoromethyl)phenyl]phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium.
| Compound Name | 5-[[4-[4-bromo-3-(trifluoromethyl)phenyl]phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium |
|---|---|
| PubChem CID | 91394205 |
| Molecular Formula | C25H15BrF5N4+ |
| Molecular Weight | 546.32 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | 5-[[4-[4-bromo-3-(trifluoromethyl)phenyl]phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-d]pyridazin-5-ium |
| SMILES | Fc1cccc(-c2nc3cn[n+](Cc4ccc(-c5ccc(Br)c(C(F)(F)F)c5)cc4)cc3[nH]2)c1F |
| InChI | InChI=1S/C25H14BrF5N4/c26-19-9-8-16(10-18(19)25(29,30)31)15-6-4-14(5-7-15)12-35-13-22-21(11-32-35)33-24(34-22)17-2-1-3-20(27)23(17)28/h1-11,13H,12H2/p+1 |
| InChIKey | FHKMDVORMLFGDE-UHFFFAOYSA-O |
| XLogP | 6.69 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.32 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|