C24H37N3O3 — CID 91394242
(E)-3-(4-acetylphenyl)-N-[(2,2-dimethylcyclopentyl)methyl]prop-2-enamide;N'-hydroxypentanimidamide (PubChem CID 91394242) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is (E)-3-(4-acetylphenyl)-N-[(2,2-dimethylcyclopentyl)methyl]prop-2-enamide;N'-hydroxypentanimidamide.
| Compound Name | (E)-3-(4-acetylphenyl)-N-[(2,2-dimethylcyclopentyl)methyl]prop-2-enamide;N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 91394242 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | (E)-3-(4-acetylphenyl)-N-[(2,2-dimethylcyclopentyl)methyl]prop-2-enamide;N'-hydroxypentanimidamide |
| SMILES | CC(=O)c1ccc(/C=C/C(=O)NCC2CCCC2(C)C)cc1.CCCC/C(N)=N\O |
| InChI | InChI=1S/C19H25NO2.C5H12N2O/c1-14(21)16-9-6-15(7-10-16)8-11-18(22)20-13-17-5-4-12-19(17,2)3;1-2-3-4-5(6)7-8/h6-11,17H,4-5,12-13H2,1-3H3,(H,20,22);8H,2-4H2,1H3,(H2,6,7)/b11-8+; |
| InChIKey | GNRLPIHOCFZRES-YGCVIUNWSA-N |
| XLogP | 4.77 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|