C24H26N2OS — CID 91394537
1-benzhydryl-3-[2-(2-methoxy-5-methylphenyl)ethyl]thiourea (PubChem CID 91394537) has the molecular formula C24H26N2OS and a molecular weight of 390.55 g/mol. Its IUPAC name is 1-benzhydryl-3-[2-(2-methoxy-5-methylphenyl)ethyl]thiourea.
| Compound Name | 1-benzhydryl-3-[2-(2-methoxy-5-methylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 91394537 |
| Molecular Formula | C24H26N2OS |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-benzhydryl-3-[2-(2-methoxy-5-methylphenyl)ethyl]thiourea |
| SMILES | COc1ccc(C)cc1CCNC(=S)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N2OS/c1-18-13-14-22(27-2)21(17-18)15-16-25-24(28)26-23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17,23H,15-16H2,1-2H3,(H2,25,26,28) |
| InChIKey | LNSVUXNXQLNZBA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|