C38H59NO3 — CID 91395046
methyl 6-[4-[6-(aminomethyl)-3-methylundecan-2-yl]-2-phenylphenyl]-2-butyl-3,4-dimethyl-6-oxohexanoate (PubChem CID 91395046) has the molecular formula C38H59NO3 and a molecular weight of 577.89 g/mol. Its IUPAC name is methyl 6-[4-[6-(aminomethyl)-3-methylundecan-2-yl]-2-phenylphenyl]-2-butyl-3,4-dimethyl-6-oxohexanoate.
| Compound Name | methyl 6-[4-[6-(aminomethyl)-3-methylundecan-2-yl]-2-phenylphenyl]-2-butyl-3,4-dimethyl-6-oxohexanoate |
|---|---|
| PubChem CID | 91395046 |
| Molecular Formula | C38H59NO3 |
| Molecular Weight | 577.89 g/mol |
| Exact Mass | 577.45 |
| IUPAC Name | methyl 6-[4-[6-(aminomethyl)-3-methylundecan-2-yl]-2-phenylphenyl]-2-butyl-3,4-dimethyl-6-oxohexanoate |
| SMILES | CCCCCC(CN)CCC(C)C(C)c1ccc(C(=O)CC(C)C(C)C(CCCC)C(=O)OC)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C38H59NO3/c1-8-10-13-16-31(26-39)21-20-27(3)29(5)33-22-23-35(36(25-33)32-17-14-12-15-18-32)37(40)24-28(4)30(6)34(19-11-9-2)38(41)42-7/h12,14-15,17-18,22-23,25,27-31,34H,8-11,13,16,19-21,24,26,39H2,1-7H3 |
| InChIKey | RQBBUFUGPRGFEE-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.89 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|