C12H10N2O4S — CID 91395080
6-but-2-ynyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid (PubChem CID 91395080) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 6-but-2-ynyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid.
| Compound Name | 6-but-2-ynyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91395080 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 6-but-2-ynyl-8-methyl-5,7-dioxo-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
| SMILES | CC#CCn1c(=O)c(C)c2sc(C(=O)O)cn2c1=O |
| InChI | InChI=1S/C12H10N2O4S/c1-3-4-5-13-9(15)7(2)10-14(12(13)18)6-8(19-10)11(16)17/h6H,5H2,1-2H3,(H,16,17) |
| InChIKey | NHKPWSLHQSHAML-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|