About 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine
1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine (PubChem CID 91395297) has the molecular formula C19H25N3
and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine.
Molecular Properties
| Compound Name | 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine |
| PubChem CID | 91395297 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine |
| SMILES | Nc1ccc(N(CC2CCCCC2)c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C19H25N3/c20-16-11-12-19(18(21)13-16)22(17-9-5-2-6-10-17)14-15-7-3-1-4-8-15/h2,5-6,9-13,15H,1,3-4,7-8,14,20-21H2 |
| InChIKey | BNHOLOPFHXECGP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine?
The IUPAC name of 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine (CID 91395297) is 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine.
What is the SMILES notation for 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine?
The canonical SMILES for 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine is Nc1ccc(N(CC2CCCCC2)c2ccccc2)c(N)c1.
What is the InChIKey of 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine?
The InChIKey is BNHOLOPFHXECGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3/c20-16-11-12-19(18(21)13-16)22(17-9-5-2-6-10-17)14-15-7-3-1-4-8-15/h2,5-6,9-13,15H,1,3-4,7-8,14,20-21H2.
What are the key properties of 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine?
1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine has a molecular weight of 295.43 g/mol, XLogP of 4.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(cyclohexylmethyl)-1-N-phenylbenzene-1,2,4-triamine is sourced from PubChem (CID 91395297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).