C22H25NO6 — CID 91396234
trimethyl 8-methyl-3-phenyl-3,4,4a,7-tetrahydro-1H-isoquinoline-2,5,6-tricarboxylate (PubChem CID 91396234) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is trimethyl 8-methyl-3-phenyl-3,4,4a,7-tetrahydro-1H-isoquinoline-2,5,6-tricarboxylate.
| Compound Name | trimethyl 8-methyl-3-phenyl-3,4,4a,7-tetrahydro-1H-isoquinoline-2,5,6-tricarboxylate |
|---|---|
| PubChem CID | 91396234 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | trimethyl 8-methyl-3-phenyl-3,4,4a,7-tetrahydro-1H-isoquinoline-2,5,6-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2CC(c3ccccc3)N(C(=O)OC)CC2=C(C)C1 |
| InChI | InChI=1S/C22H25NO6/c1-13-10-16(20(24)27-2)19(21(25)28-3)15-11-18(14-8-6-5-7-9-14)23(12-17(13)15)22(26)29-4/h5-9,15,18H,10-12H2,1-4H3 |
| InChIKey | UXHSTISWZYLIEW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|