C8H13N3O — CID 91396399
[(2R,5S)-5-(1H-imidazol-2-yl)oxolan-2-yl]methanamine (PubChem CID 91396399) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is [(2R,5S)-5-(1H-imidazol-2-yl)oxolan-2-yl]methanamine.
| Compound Name | [(2R,5S)-5-(1H-imidazol-2-yl)oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 91396399 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | [(2R,5S)-5-(1H-imidazol-2-yl)oxolan-2-yl]methanamine |
| SMILES | NC[C@H]1CC[C@@H](c2ncc[nH]2)O1 |
| InChI | InChI=1S/C8H13N3O/c9-5-6-1-2-7(12-6)8-10-3-4-11-8/h3-4,6-7H,1-2,5,9H2,(H,10,11)/t6-,7+/m1/s1 |
| InChIKey | WHKSNUKEXRRTJJ-RQJHMYQMSA-N |
| XLogP | 0.59 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |