C12H5ClF3N3OS — CID 91396738
3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde (PubChem CID 91396738) has the molecular formula C12H5ClF3N3OS and a molecular weight of 331.71 g/mol. Its IUPAC name is 3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde.
| Compound Name | 3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 91396738 |
| Molecular Formula | C12H5ClF3N3OS |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbaldehyde |
| SMILES | O=Cc1nn2c(C(F)(F)F)cc(-c3cccs3)nc2c1Cl |
| InChI | InChI=1S/C12H5ClF3N3OS/c13-10-7(5-20)18-19-9(12(14,15)16)4-6(17-11(10)19)8-2-1-3-21-8/h1-5H |
| InChIKey | WIMDKKDTWAARHT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|