About 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]
3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] (PubChem CID 91396882) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole].
Molecular Properties
| Compound Name | 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] |
| PubChem CID | 91396882 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] |
| SMILES | C1=C(c2cccnc2)NOC12CN1CCC2CC1 |
| InChI | InChI=1S/C14H17N3O/c1-2-11(9-15-5-1)13-8-14(18-16-13)10-17-6-3-12(14)4-7-17/h1-2,5,8-9,12,16H,3-4,6-7,10H2 |
| InChIKey | HGSVZVDVESRERL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
The IUPAC name of 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] (CID 91396882) is 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole].
What is the SMILES notation for 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
The canonical SMILES for 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] is C1=C(c2cccnc2)NOC12CN1CCC2CC1.
What is the InChIKey of 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
The InChIKey is HGSVZVDVESRERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c1-2-11(9-15-5-1)13-8-14(18-16-13)10-17-6-3-12(14)4-7-17/h1-2,5,8-9,12,16H,3-4,6-7,10H2.
What are the key properties of 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole]?
3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] has a molecular weight of 243.31 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-pyridin-3-ylspiro[1-azabicyclo[2.2.2]octane-3,5'-2H-1,2-oxazole] is sourced from PubChem (CID 91396882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).