C19H31FN2O — CID 91397329
N-[3-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propyl]butan-2-amine (PubChem CID 91397329) has the molecular formula C19H31FN2O and a molecular weight of 322.47 g/mol. Its IUPAC name is N-[3-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propyl]butan-2-amine.
| Compound Name | N-[3-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propyl]butan-2-amine |
|---|---|
| PubChem CID | 91397329 |
| Molecular Formula | C19H31FN2O |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-[3-[2-[(4-fluorophenyl)methyl]-1,4-oxazepan-4-yl]propyl]butan-2-amine |
| SMILES | CCC(C)NCCCN1CCCOC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H31FN2O/c1-3-16(2)21-10-4-11-22-12-5-13-23-19(15-22)14-17-6-8-18(20)9-7-17/h6-9,16,19,21H,3-5,10-15H2,1-2H3 |
| InChIKey | NWUQKCGPTBVYKA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|