C15H11Cl2N — CID 91397746
6-chloro-3-[(3-chlorophenyl)methylidene]-1,2-dihydroindole (PubChem CID 91397746) has the molecular formula C15H11Cl2N and a molecular weight of 276.17 g/mol. Its IUPAC name is 6-chloro-3-[(3-chlorophenyl)methylidene]-1,2-dihydroindole.
| Compound Name | 6-chloro-3-[(3-chlorophenyl)methylidene]-1,2-dihydroindole |
|---|---|
| PubChem CID | 91397746 |
| Molecular Formula | C15H11Cl2N |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 6-chloro-3-[(3-chlorophenyl)methylidene]-1,2-dihydroindole |
| SMILES | Clc1cccc(C=C2CNc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C15H11Cl2N/c16-12-3-1-2-10(7-12)6-11-9-18-15-8-13(17)4-5-14(11)15/h1-8,18H,9H2 |
| InChIKey | GMYBYAWXUYUYKC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|