C16H21NO2 — CID 91397869
3,6-dimethyl-4-phenylmethoxy-1H-pyridin-2-one;ethane (PubChem CID 91397869) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3,6-dimethyl-4-phenylmethoxy-1H-pyridin-2-one;ethane.
| Compound Name | 3,6-dimethyl-4-phenylmethoxy-1H-pyridin-2-one;ethane |
|---|---|
| PubChem CID | 91397869 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 3,6-dimethyl-4-phenylmethoxy-1H-pyridin-2-one;ethane |
| SMILES | CC.Cc1cc(OCc2ccccc2)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C14H15NO2.C2H6/c1-10-8-13(11(2)14(16)15-10)17-9-12-6-4-3-5-7-12;1-2/h3-8H,9H2,1-2H3,(H,15,16);1-2H3 |
| InChIKey | BLNPCOXLURKLFG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |