About 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid
3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid (PubChem CID 91397967) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid.
Analyze 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid?
The IUPAC name of 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid (CID 91397967) is 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid.
What is the SMILES notation for 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid?
The canonical SMILES for 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid is O=C(O)C1=CCN2CC3CCC(CC3)C2=N1.
What is the InChIKey of 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid?
The InChIKey is MNPHZBHXFNSQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c15-12(16)10-5-6-14-7-8-1-3-9(4-2-8)11(14)13-10/h5,8-9H,1-4,6-7H2,(H,15,16).
What are the key properties of 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid?
3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid has a molecular weight of 220.27 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-diene-4-carboxylic acid is sourced from PubChem (CID 91397967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).