C15H25N — CID 91398120
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrole;ethane (PubChem CID 91398120) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrole;ethane.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrole;ethane |
|---|---|
| PubChem CID | 91398120 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrole;ethane |
| SMILES | CC.c1ccn(C2CC3CCCCC3C2)c1 |
| InChI | InChI=1S/C13H19N.C2H6/c1-2-6-12-10-13(9-11(12)5-1)14-7-3-4-8-14;1-2/h3-4,7-8,11-13H,1-2,5-6,9-10H2;1-2H3 |
| InChIKey | FTVSHTPVHBSLCF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |