C20H21N3O7 — CID 91398171
(2S)-2-[(S)-(N-formyl-3,5-dinitroanilino)-phenylmethyl]-3,3-dimethylbutanoic acid (PubChem CID 91398171) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is (2S)-2-[(S)-(N-formyl-3,5-dinitroanilino)-phenylmethyl]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(S)-(N-formyl-3,5-dinitroanilino)-phenylmethyl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 91398171 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (2S)-2-[(S)-(N-formyl-3,5-dinitroanilino)-phenylmethyl]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](C(=O)O)[C@@H](c1ccccc1)N(C=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N3O7/c1-20(2,3)17(19(25)26)18(13-7-5-4-6-8-13)21(12-24)14-9-15(22(27)28)11-16(10-14)23(29)30/h4-12,17-18H,1-3H3,(H,25,26)/t17-,18+/m0/s1 |
| InChIKey | AAHCLDWTPMHVCQ-ZWKOTPCHSA-N |
| XLogP | 3.95 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|