C16H34N2O3 — CID 91398430
(dimethylamino)methyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide (PubChem CID 91398430) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is (dimethylamino)methyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide.
| Compound Name | (dimethylamino)methyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide |
|---|---|
| PubChem CID | 91398430 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (dimethylamino)methyl 2,2-dimethylbutanoate;N,N,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)OCN(C)C.CCC(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H19NO2.C7H15NO/c1-6-9(2,3)8(11)12-7-10(4)5;1-5-6(2)7(9)8(3)4/h6-7H2,1-5H3;6H,5H2,1-4H3 |
| InChIKey | SRTPBOBAMHQMCA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|