C24H44O8 — CID 91398623
1-[(2S,3S,4S,5S)-5-acetyl-3,4,5-trihydroxy-6-(3-methylpentyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one (PubChem CID 91398623) has the molecular formula C24H44O8 and a molecular weight of 460.61 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5S)-5-acetyl-3,4,5-trihydroxy-6-(3-methylpentyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one.
| Compound Name | 1-[(2S,3S,4S,5S)-5-acetyl-3,4,5-trihydroxy-6-(3-methylpentyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 91398623 |
| Molecular Formula | C24H44O8 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 1-[(2S,3S,4S,5S)-5-acetyl-3,4,5-trihydroxy-6-(3-methylpentyl)-6-octoxyoxan-2-yl]-2-hydroxypropan-1-one |
| SMILES | CCCCCCCCOC1(CCC(C)CC)O[C@H](C(=O)C(C)O)[C@@H](O)[C@H](O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C24H44O8/c1-6-8-9-10-11-12-15-31-23(14-13-16(3)7-2)24(30,18(5)26)22(29)20(28)21(32-23)19(27)17(4)25/h16-17,20-22,25,28-30H,6-15H2,1-5H3/t16?,17?,20-,21-,22+,23?,24-/m1/s1 |
| InChIKey | RSRBCNOXJSFDBA-HOIVPYLGSA-N |
| XLogP | 2.28 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|