C23H27N3+2 — CID 91398707
2,9-diphenyl-10-aza-2,9-diazoniatricyclo[5.2.1.04,10]deca-2,4,6,8-tetraene;ethane (PubChem CID 91398707) has the molecular formula C23H27N3+2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2,9-diphenyl-10-aza-2,9-diazoniatricyclo[5.2.1.04,10]deca-2,4,6,8-tetraene;ethane.
| Compound Name | 2,9-diphenyl-10-aza-2,9-diazoniatricyclo[5.2.1.04,10]deca-2,4,6,8-tetraene;ethane |
|---|---|
| PubChem CID | 91398707 |
| Molecular Formula | C23H27N3+2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2,9-diphenyl-10-aza-2,9-diazoniatricyclo[5.2.1.04,10]deca-2,4,6,8-tetraene;ethane |
| SMILES | C1=[N+](c2ccccc2)C2n3c1ccc3C=[N+]2c1ccccc1.CC.CC |
| InChI | InChI=1S/C19H15N3.2C2H6/c1-3-7-15(8-4-1)20-13-17-11-12-18-14-21(19(20)22(17)18)16-9-5-2-6-10-16;2*1-2/h1-14,19H;2*1-2H3/q+2;; |
| InChIKey | RYQLBLDRSCODST-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 10.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|