C18H15BrF2N2O — CID 91399090
5-[5-[bromo(difluoro)methoxy]-1,3-dihydroisoindol-2-yl]-1-methylindole (PubChem CID 91399090) has the molecular formula C18H15BrF2N2O and a molecular weight of 393.23 g/mol. Its IUPAC name is 5-[5-[bromo(difluoro)methoxy]-1,3-dihydroisoindol-2-yl]-1-methylindole.
| Compound Name | 5-[5-[bromo(difluoro)methoxy]-1,3-dihydroisoindol-2-yl]-1-methylindole |
|---|---|
| PubChem CID | 91399090 |
| Molecular Formula | C18H15BrF2N2O |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 5-[5-[bromo(difluoro)methoxy]-1,3-dihydroisoindol-2-yl]-1-methylindole |
| SMILES | Cn1ccc2cc(N3Cc4ccc(OC(F)(F)Br)cc4C3)ccc21 |
| InChI | InChI=1S/C18H15BrF2N2O/c1-22-7-6-12-8-15(3-5-17(12)22)23-10-13-2-4-16(9-14(13)11-23)24-18(19,20)21/h2-9H,10-11H2,1H3 |
| InChIKey | WPHNBNMTRLRYDG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|