C11H16O2 — CID 91399110
4,7-dimethyl-3,4,5,6,7,8-hexahydroisochromen-1-one (PubChem CID 91399110) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4,7-dimethyl-3,4,5,6,7,8-hexahydroisochromen-1-one.
| Compound Name | 4,7-dimethyl-3,4,5,6,7,8-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 91399110 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4,7-dimethyl-3,4,5,6,7,8-hexahydroisochromen-1-one |
| SMILES | CC1CCC2=C(C1)C(=O)OCC2C |
| InChI | InChI=1S/C11H16O2/c1-7-3-4-9-8(2)6-13-11(12)10(9)5-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | FNXSRQAYWVYHCJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |