About 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole
5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole (PubChem CID 91399276) has the molecular formula C7H6N2OS
and a molecular weight of 166.20 g/mol. Its IUPAC name is 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole |
| PubChem CID | 91399276 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole |
| SMILES | Cc1cc(-c2nccs2)no1 |
| InChI | InChI=1S/C7H6N2OS/c1-5-4-6(9-10-5)7-8-2-3-11-7/h2-4H,1H3 |
| InChIKey | XAEZVBCTYVVYGW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole?
The IUPAC name of 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole (CID 91399276) is 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole.
What is the SMILES notation for 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole?
The canonical SMILES for 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole is Cc1cc(-c2nccs2)no1.
What is the InChIKey of 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole?
The InChIKey is XAEZVBCTYVVYGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c1-5-4-6(9-10-5)7-8-2-3-11-7/h2-4H,1H3.
What are the key properties of 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole?
5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole has a molecular weight of 166.20 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(1,3-thiazol-2-yl)-1,2-oxazole is sourced from PubChem (CID 91399276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).