C28H23N3O3 — CID 91399416
5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91399416) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one.
| Compound Name | 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91399416 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | COc1cc2c(cc1OC)C(/C(=N/c1ccc(-c3ccccn3)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C28H23N3O3/c1-33-24-16-21-23(17-25(24)34-2)31-28(32)26(21)27(19-8-4-3-5-9-19)30-20-13-11-18(12-14-20)22-10-6-7-15-29-22/h3-17,26H,1-2H3,(H,31,32)/b30-27+ |
| InChIKey | CFKBHIPHFRMIAS-KDJFERLWSA-N |
| XLogP | 5.62 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|