About 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one
5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one (PubChem CID 91399416) has the molecular formula C28H23N3O3
and a molecular weight of 449.51 g/mol. Its IUPAC name is 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one |
| PubChem CID | 91399416 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one |
| SMILES | COc1cc2c(cc1OC)C(/C(=N/c1ccc(-c3ccccn3)cc1)c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C28H23N3O3/c1-33-24-16-21-23(17-25(24)34-2)31-28(32)26(21)27(19-8-4-3-5-9-19)30-20-13-11-18(12-14-20)22-10-6-7-15-29-22/h3-17,26H,1-2H3,(H,31,32)/b30-27+ |
| InChIKey | CFKBHIPHFRMIAS-KDJFERLWSA-N |
| XLogP | 5.62 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one?
The IUPAC name of 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one (CID 91399416) is 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one.
What is the SMILES notation for 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one?
The canonical SMILES for 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one is COc1cc2c(cc1OC)C(/C(=N/c1ccc(-c3ccccn3)cc1)c1ccccc1)C(=O)N2.
What is the InChIKey of 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one?
The InChIKey is CFKBHIPHFRMIAS-KDJFERLWSA-N. The full InChI is InChI=1S/C28H23N3O3/c1-33-24-16-21-23(17-25(24)34-2)31-28(32)26(21)27(19-8-4-3-5-9-19)30-20-13-11-18(12-14-20)22-10-6-7-15-29-22/h3-17,26H,1-2H3,(H,31,32)/b30-27+.
What are the key properties of 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one?
5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one has a molecular weight of 449.51 g/mol, XLogP of 5.62, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1,3-dihydroindol-2-one is sourced from PubChem (CID 91399416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).