C18H15N5O3S — CID 91399730
2-(4-nitrophenyl)-N-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]acetamide (PubChem CID 91399730) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]acetamide.
| Compound Name | 2-(4-nitrophenyl)-N-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 91399730 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(4-nitrophenyl)-N-[2-(1,3-thiazol-4-yl)-2,3-dihydro-1H-benzimidazol-5-yl]acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Nc1ccc2c(c1)NC(c1cscn1)N2 |
| InChI | InChI=1S/C18H15N5O3S/c24-17(7-11-1-4-13(5-2-11)23(25)26)20-12-3-6-14-15(8-12)22-18(21-14)16-9-27-10-19-16/h1-6,8-10,18,21-22H,7H2,(H,20,24) |
| InChIKey | VNUMUDADCKUAJA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|