C24H26F3N3O2S — CID 91399874
tert-butyl 6-cyclopropyl-2-[5-(1,1,1-trifluoropropan-2-ylamino)sulfanyl-2-pyridinyl]indole-1-carboxylate (PubChem CID 91399874) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is tert-butyl 6-cyclopropyl-2-[5-(1,1,1-trifluoropropan-2-ylamino)sulfanyl-2-pyridinyl]indole-1-carboxylate.
| Compound Name | tert-butyl 6-cyclopropyl-2-[5-(1,1,1-trifluoropropan-2-ylamino)sulfanyl-2-pyridinyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 91399874 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | tert-butyl 6-cyclopropyl-2-[5-(1,1,1-trifluoropropan-2-ylamino)sulfanyl-2-pyridinyl]indole-1-carboxylate |
| SMILES | CC(NSc1ccc(-c2cc3ccc(C4CC4)cc3n2C(=O)OC(C)(C)C)nc1)C(F)(F)F |
| InChI | InChI=1S/C24H26F3N3O2S/c1-14(24(25,26)27)29-33-18-9-10-19(28-13-18)21-12-17-8-7-16(15-5-6-15)11-20(17)30(21)22(31)32-23(2,3)4/h7-15,29H,5-6H2,1-4H3 |
| InChIKey | KCHRMDBPJVEKOZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|