C19H26N4O4 — CID 91400100
ethane;methyl 6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidine-4-carboxylate (PubChem CID 91400100) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethane;methyl 6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidine-4-carboxylate.
| Compound Name | ethane;methyl 6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 91400100 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethane;methyl 6-morpholin-4-yl-2-(2-pyridin-2-ylethoxy)pyrimidine-4-carboxylate |
| SMILES | CC.COC(=O)c1cc(N2CCOCC2)nc(OCCc2ccccn2)n1 |
| InChI | InChI=1S/C17H20N4O4.C2H6/c1-23-16(22)14-12-15(21-7-10-24-11-8-21)20-17(19-14)25-9-5-13-4-2-3-6-18-13;1-2/h2-4,6,12H,5,7-11H2,1H3;1-2H3 |
| InChIKey | VLLMPGGLGCOVSZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |