C29H32BO2PS — CID 91400469
4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane;triphenylphosphane (PubChem CID 91400469) has the molecular formula C29H32BO2PS and a molecular weight of 486.43 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane;triphenylphosphane.
| Compound Name | 4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane;triphenylphosphane |
|---|---|
| PubChem CID | 91400469 |
| Molecular Formula | C29H32BO2PS |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane;triphenylphosphane |
| SMILES | Cc1ccsc1B1OC(C)(C)C(C)(C)O1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C11H17BO2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8-6-7-15-9(8)12-13-10(2,3)11(4,5)14-12/h1-15H;6-7H,1-5H3 |
| InChIKey | BBGBXFSWPAYXHO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|