C15H14Cl2N2O5 — CID 91400717
(1S,2R,4R,5S,6R)-2-amino-4-[(3,4-dichlorobenzoyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 91400717) has the molecular formula C15H14Cl2N2O5 and a molecular weight of 373.19 g/mol. Its IUPAC name is (1S,2R,4R,5S,6R)-2-amino-4-[(3,4-dichlorobenzoyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2R,4R,5S,6R)-2-amino-4-[(3,4-dichlorobenzoyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91400717 |
| Molecular Formula | C15H14Cl2N2O5 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (1S,2R,4R,5S,6R)-2-amino-4-[(3,4-dichlorobenzoyl)amino]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)C[C@@H](NC(=O)c2ccc(Cl)c(Cl)c2)[C@@H]2[C@@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C15H14Cl2N2O5/c16-6-2-1-5(3-7(6)17)12(20)19-8-4-15(18,14(23)24)11-9(8)10(11)13(21)22/h1-3,8-11H,4,18H2,(H,19,20)(H,21,22)(H,23,24)/t8-,9-,10-,11+,15-/m1/s1 |
| InChIKey | WCFGESHUXTWMLI-JAPZVGMSSA-N |
| XLogP | 1.22 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |