About benzylbenzene;N,N'-dimethylmethanediimine;ethane
benzylbenzene;N,N'-dimethylmethanediimine;ethane (PubChem CID 91400780) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is benzylbenzene;N,N'-dimethylmethanediimine;ethane.
Molecular Properties
| Compound Name | benzylbenzene;N,N'-dimethylmethanediimine;ethane |
| PubChem CID | 91400780 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | benzylbenzene;N,N'-dimethylmethanediimine;ethane |
| SMILES | CC.CN=C=NC.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C3H6N2.C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-4-3-5-2;1-2/h1-10H,11H2;1-2H3;1-2H3 |
| InChIKey | BFCYYJYNLSPUAH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzylbenzene;N,N'-dimethylmethanediimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylbenzene;N,N'-dimethylmethanediimine;ethane?
The IUPAC name of benzylbenzene;N,N'-dimethylmethanediimine;ethane (CID 91400780) is benzylbenzene;N,N'-dimethylmethanediimine;ethane.
What is the SMILES notation for benzylbenzene;N,N'-dimethylmethanediimine;ethane?
The canonical SMILES for benzylbenzene;N,N'-dimethylmethanediimine;ethane is CC.CN=C=NC.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of benzylbenzene;N,N'-dimethylmethanediimine;ethane?
The InChIKey is BFCYYJYNLSPUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C3H6N2.C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-4-3-5-2;1-2/h1-10H,11H2;1-2H3;1-2H3.
What are the key properties of benzylbenzene;N,N'-dimethylmethanediimine;ethane?
benzylbenzene;N,N'-dimethylmethanediimine;ethane has a molecular weight of 268.40 g/mol, XLogP of 4.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylbenzene;N,N'-dimethylmethanediimine;ethane is sourced from PubChem (CID 91400780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).