C10H4F12N2 — CID 91400808
1-N,1-N,3,4-tetrakis(trifluoromethyl)benzene-1,2-diamine (PubChem CID 91400808) has the molecular formula C10H4F12N2 and a molecular weight of 380.13 g/mol. Its IUPAC name is 1-N,1-N,3,4-tetrakis(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N,1-N,3,4-tetrakis(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 91400808 |
| Molecular Formula | C10H4F12N2 |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 1-N,1-N,3,4-tetrakis(trifluoromethyl)benzene-1,2-diamine |
| SMILES | Nc1c(N(C(F)(F)F)C(F)(F)F)ccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H4F12N2/c11-7(12,13)3-1-2-4(6(23)5(3)8(14,15)16)24(9(17,18)19)10(20,21)22/h1-2H,23H2 |
| InChIKey | BNESKAOZMSXWHA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|