About 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol
2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol (PubChem CID 91400840) has the molecular formula C9H16NO4PS
and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol |
| PubChem CID | 91400840 |
| Molecular Formula | C9H16NO4PS |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol |
| SMILES | CCOP(=O)(CC(O)c1cscn1)OCC |
| InChI | InChI=1S/C9H16NO4PS/c1-3-13-15(12,14-4-2)5-9(11)8-6-16-7-10-8/h6-7,9,11H,3-5H2,1-2H3 |
| InChIKey | IBMHRHLHMXNXEH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol?
The IUPAC name of 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol (CID 91400840) is 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol.
What is the SMILES notation for 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol?
The canonical SMILES for 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol is CCOP(=O)(CC(O)c1cscn1)OCC.
What is the InChIKey of 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol?
The InChIKey is IBMHRHLHMXNXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16NO4PS/c1-3-13-15(12,14-4-2)5-9(11)8-6-16-7-10-8/h6-7,9,11H,3-5H2,1-2H3.
What are the key properties of 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol?
2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol has a molecular weight of 265.27 g/mol, XLogP of 2.44, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphoryl-1-(1,3-thiazol-4-yl)ethanol is sourced from PubChem (CID 91400840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).