C13H12F3NO2 — CID 91401042
1-benzyl-3-(2,2,2-trifluoroethyl)pyrrole-2,5-diol (PubChem CID 91401042) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-benzyl-3-(2,2,2-trifluoroethyl)pyrrole-2,5-diol.
| Compound Name | 1-benzyl-3-(2,2,2-trifluoroethyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91401042 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-benzyl-3-(2,2,2-trifluoroethyl)pyrrole-2,5-diol |
| SMILES | Oc1cc(CC(F)(F)F)c(O)n1Cc1ccccc1 |
| InChI | InChI=1S/C13H12F3NO2/c14-13(15,16)7-10-6-11(18)17(12(10)19)8-9-4-2-1-3-5-9/h1-6,18-19H,7-8H2 |
| InChIKey | QTGLULZLDJLKNN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |