C17H11NOS2 — CID 91401146
3-(furan-3-yl)-2,6-dithiophen-2-ylpyridine (PubChem CID 91401146) has the molecular formula C17H11NOS2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 3-(furan-3-yl)-2,6-dithiophen-2-ylpyridine.
| Compound Name | 3-(furan-3-yl)-2,6-dithiophen-2-ylpyridine |
|---|---|
| PubChem CID | 91401146 |
| Molecular Formula | C17H11NOS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-(furan-3-yl)-2,6-dithiophen-2-ylpyridine |
| SMILES | c1csc(-c2ccc(-c3ccoc3)c(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C17H11NOS2/c1-3-15(20-9-1)14-6-5-13(12-7-8-19-11-12)17(18-14)16-4-2-10-21-16/h1-11H |
| InChIKey | IHTJSRMKNWTSDG-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |