C26H38N2O3 — CID 91401305
[(1R,4aR,6R,12aR)-11-(hydroxymethyl)-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] 3-(1-methylimidazol-4-yl)prop-2-enoate (PubChem CID 91401305) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is [(1R,4aR,6R,12aR)-11-(hydroxymethyl)-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] 3-(1-methylimidazol-4-yl)prop-2-enoate.
| Compound Name | [(1R,4aR,6R,12aR)-11-(hydroxymethyl)-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] 3-(1-methylimidazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 91401305 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | [(1R,4aR,6R,12aR)-11-(hydroxymethyl)-4-methyl-1-propan-2-yl-1,2,4a,5,6,7,10,11,12,12a-decahydrobenzo[10]annulen-6-yl] 3-(1-methylimidazol-4-yl)prop-2-enoate |
| SMILES | CC1=CC[C@H](C(C)C)[C@H]2CC(CO)CC=CC[C@@H](OC(=O)C=Cc3cn(C)cn3)C[C@@H]12 |
| InChI | InChI=1S/C26H38N2O3/c1-18(2)23-11-9-19(3)24-14-22(8-6-5-7-20(16-29)13-25(23)24)31-26(30)12-10-21-15-28(4)17-27-21/h5-6,9-10,12,15,17-18,20,22-25,29H,7-8,11,13-14,16H2,1-4H3/t20?,22-,23-,24+,25-/m1/s1 |
| InChIKey | LOILTCZFMSINKF-BKOMXBJOSA-N |
| XLogP | 4.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|