C19H45N5O2 — CID 91401807
N'-[1-(ethylamino)ethyl]-N-methylpropane-1,3-diamine;methyl 5-[3-(methylamino)propylamino]hexanoate (PubChem CID 91401807) has the molecular formula C19H45N5O2 and a molecular weight of 375.60 g/mol. Its IUPAC name is N'-[1-(ethylamino)ethyl]-N-methylpropane-1,3-diamine;methyl 5-[3-(methylamino)propylamino]hexanoate.
| Compound Name | N'-[1-(ethylamino)ethyl]-N-methylpropane-1,3-diamine;methyl 5-[3-(methylamino)propylamino]hexanoate |
|---|---|
| PubChem CID | 91401807 |
| Molecular Formula | C19H45N5O2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.36 |
| IUPAC Name | N'-[1-(ethylamino)ethyl]-N-methylpropane-1,3-diamine;methyl 5-[3-(methylamino)propylamino]hexanoate |
| SMILES | CCNC(C)NCCCNC.CNCCCNC(C)CCCC(=O)OC |
| InChI | InChI=1S/C11H24N2O2.C8H21N3/c1-10(13-9-5-8-12-2)6-4-7-11(14)15-3;1-4-10-8(2)11-7-5-6-9-3/h10,12-13H,4-9H2,1-3H3;8-11H,4-7H2,1-3H3 |
| InChIKey | DOUXWDSVEKYSJM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|